netoisbeautiful6887 netoisbeautiful6887
  • 04-06-2018
  • Mathematics
contestada

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

Respuesta :

Аноним Аноним
  • 04-06-2018
We use the identity  sin (A - B) = sin A cos B - cos B sin A

so the above  = sin (11pi/12 -  pi/6) = sin 3pi/4 =  1 / sqrt2 answer
Answer Link

Otras preguntas

How are polynomials with operations, like other number systems, such as whole numbers and integers?
Find the missing value in the table of equivalent ratios.
Which nitrogen base sequence is the partner of C–A–T–C–G–A?
PLEASE HELP WILL GIVE BRAINLIST AND 50 POINTS! Review the module writing prompt. How have these two authors expressed their relationships with nature? After rea
Urbanization is best described as the _____
5/3v = 125/7 PLEASE HELP
How does this detail best support the theme that people fulfill their own predictions? It suggests that the crowd is not welcoming an outsider. It proves that t
Which of the following elements has the lowest ionization energy? Na C F He Rb
A glucose molecule is the
How do we know what is inside of Earth ?