raaeraae22
raaeraae22 raaeraae22
  • 04-02-2017
  • Chemistry
contestada

When is di- used in the name of a hydrocarbon?

Respuesta :

DoctorCass
DoctorCass DoctorCass
  • 04-02-2017
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer Link

Otras preguntas

What can cause, but not excuse, child abuse?
James observes that the Polaris star in the northern hemisphere does not rise and set in the sky. His teacher tells him that this is because Earth rotates aroun
how many molecules are in 62.01 grams of CO
can someone please define variation for me?
Use a graphing calculator to solve the equation in the interval from 0 to 2pi. Round to the nearest hundredth. 7cos2t=3 explain your steps
A(n) ______ is someone who is not in the military.
Why are so many of our modern american buildings such as banks, schools, and courthouses built to look like greek and roman temples?
What are the answers to these 2 question 4&5 PLZ HELP
(log3 x)^2+2log3x-24=0
who were the sons of liberty?